C22H20F3NO8S — CID 59319801
5,8-bis(2-ethenoxyethoxy)-2-(trifluoromethylsulfonylmethyl)benzo[de]isoquinoline-1,3-dione (PubChem CID 59319801) has the molecular formula C22H20F3NO8S and a molecular weight of 515.46 g/mol. Its IUPAC name is 5,8-bis(2-ethenoxyethoxy)-2-(trifluoromethylsulfonylmethyl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 5,8-bis(2-ethenoxyethoxy)-2-(trifluoromethylsulfonylmethyl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 59319801 |
| Molecular Formula | C22H20F3NO8S |
| Molecular Weight | 515.46 g/mol |
| Exact Mass | 515.09 |
| IUPAC Name | 5,8-bis(2-ethenoxyethoxy)-2-(trifluoromethylsulfonylmethyl)benzo[de]isoquinoline-1,3-dione |
| SMILES | C=COCCOc1cc2c3c(cc(OCCOC=C)cc3c1)C(=O)N(CS(=O)(=O)C(F)(F)F)C2=O |
| InChI | InChI=1S/C22H20F3NO8S/c1-3-31-5-7-33-15-9-14-10-16(34-8-6-32-4-2)12-18-19(14)17(11-15)20(27)26(21(18)28)13-35(29,30)22(23,24)25/h3-4,9-12H,1-2,5-8,13H2 |
| InChIKey | GJXKROOJQDYBQM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|