C18H31BO2 — CID 59320033
2,9,9-trimethyl-4-oct-7-enyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 59320033) has the molecular formula C18H31BO2 and a molecular weight of 290.26 g/mol. Its IUPAC name is 2,9,9-trimethyl-4-oct-7-enyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | 2,9,9-trimethyl-4-oct-7-enyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 59320033 |
| Molecular Formula | C18H31BO2 |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | 2,9,9-trimethyl-4-oct-7-enyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | C=CCCCCCCB1OC2CC3CC(C3(C)C)C2(C)O1 |
| InChI | InChI=1S/C18H31BO2/c1-5-6-7-8-9-10-11-19-20-16-13-14-12-15(17(14,2)3)18(16,4)21-19/h5,14-16H,1,6-13H2,2-4H3 |
| InChIKey | JAVAMTGLAFJWQK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|