C8H13N3 — CID 59320164
(3,4,5-trimethyl-2-pyridinyl)hydrazine (PubChem CID 59320164) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is (3,4,5-trimethyl-2-pyridinyl)hydrazine.
| Compound Name | (3,4,5-trimethyl-2-pyridinyl)hydrazine |
|---|---|
| PubChem CID | 59320164 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | (3,4,5-trimethyl-2-pyridinyl)hydrazine |
| SMILES | Cc1cnc(NN)c(C)c1C |
| InChI | InChI=1S/C8H13N3/c1-5-4-10-8(11-9)7(3)6(5)2/h4H,9H2,1-3H3,(H,10,11) |
| InChIKey | JTRSSZFGIMRSER-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|