C27H27F2N9O2 — CID 59320414
tert-butyl 3-[[4-[6-[difluoro-(6-methyl-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)methyl]quinolin-3-yl]pyrazol-1-yl]methyl]azetidine-1-carboxylate (PubChem CID 59320414) has the molecular formula C27H27F2N9O2 and a molecular weight of 547.57 g/mol. Its IUPAC name is tert-butyl 3-[[4-[6-[difluoro-(6-methyl-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)methyl]quinolin-3-yl]pyrazol-1-yl]methyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-[6-[difluoro-(6-methyl-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)methyl]quinolin-3-yl]pyrazol-1-yl]methyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 59320414 |
| Molecular Formula | C27H27F2N9O2 |
| Molecular Weight | 547.57 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | tert-butyl 3-[[4-[6-[difluoro-(6-methyl-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)methyl]quinolin-3-yl]pyrazol-1-yl]methyl]azetidine-1-carboxylate |
| SMILES | Cc1cnc2nnc(C(F)(F)c3ccc4ncc(-c5cnn(CC6CN(C(=O)OC(C)(C)C)C6)c5)cc4c3)n2n1 |
| InChI | InChI=1S/C27H27F2N9O2/c1-16-9-31-24-34-33-23(38(24)35-16)27(28,29)21-5-6-22-18(8-21)7-19(10-30-22)20-11-32-37(15-20)14-17-12-36(13-17)25(39)40-26(2,3)4/h5-11,15,17H,12-14H2,1-4H3 |
| InChIKey | UYXNBHRKHBALKU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 116.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |