C21H20N2O2 — CID 59320721
6-(5-methyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)pyridine-3-carboxylic acid (PubChem CID 59320721) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is 6-(5-methyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)pyridine-3-carboxylic acid.
| Compound Name | 6-(5-methyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 59320721 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 6-(5-methyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)pyridine-3-carboxylic acid |
| SMILES | CC1CCc2c(cc(-c3ccccc3)n2-c2ccc(C(=O)O)cn2)C1 |
| InChI | InChI=1S/C21H20N2O2/c1-14-7-9-18-17(11-14)12-19(15-5-3-2-4-6-15)23(18)20-10-8-16(13-22-20)21(24)25/h2-6,8,10,12-14H,7,9,11H2,1H3,(H,24,25) |
| InChIKey | RJLGOZMGYMVCCO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|