About spiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-carboxylic acid
spiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-carboxylic acid (PubChem CID 59320740) has the molecular formula C14H16O3
and a molecular weight of 232.28 g/mol. Its IUPAC name is spiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-carboxylic acid.
Molecular Properties
| Compound Name | spiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-carboxylic acid |
| PubChem CID | 59320740 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | spiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-carboxylic acid |
| SMILES | O=C(O)C1CCC2(CC1)OCc1ccccc12 |
| InChI | InChI=1S/C14H16O3/c15-13(16)10-5-7-14(8-6-10)12-4-2-1-3-11(12)9-17-14/h1-4,10H,5-9H2,(H,15,16) |
| InChIKey | XAIBYORDXNHXAG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-carboxylic acid?
The IUPAC name of spiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-carboxylic acid (CID 59320740) is spiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-carboxylic acid.
What is the SMILES notation for spiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-carboxylic acid?
The canonical SMILES for spiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-carboxylic acid is O=C(O)C1CCC2(CC1)OCc1ccccc12.
What is the InChIKey of spiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-carboxylic acid?
The InChIKey is XAIBYORDXNHXAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O3/c15-13(16)10-5-7-14(8-6-10)12-4-2-1-3-11(12)9-17-14/h1-4,10H,5-9H2,(H,15,16).
What are the key properties of spiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-carboxylic acid?
spiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-carboxylic acid has a molecular weight of 232.28 g/mol, XLogP of 2.69, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-carboxylic acid is sourced from PubChem (CID 59320740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).