C21H19F3N8O — CID 59320964
1-[3-[7-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 59320964) has the molecular formula C21H19F3N8O and a molecular weight of 456.43 g/mol. Its IUPAC name is 1-[3-[7-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[3-[7-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 59320964 |
| Molecular Formula | C21H19F3N8O |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 1-[3-[7-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)Nc1cccc(-c2cnc3cc(-c4nnc5n4CCNC5)ccn23)c1 |
| InChI | InChI=1S/C21H19F3N8O/c22-21(23,24)12-27-20(33)28-15-3-1-2-13(8-15)16-10-26-17-9-14(4-6-31(16)17)19-30-29-18-11-25-5-7-32(18)19/h1-4,6,8-10,25H,5,7,11-12H2,(H2,27,28,33) |
| InChIKey | WRHZQJFFTMDZAC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 101.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |