C16H13F4N5O5 — CID 59321691
2-[5-[3-[3-[5-fluoro-2-(trifluoromethyl)phenoxy]propoxy]-1,2-oxazol-5-yl]tetrazol-2-yl]acetic acid (PubChem CID 59321691) has the molecular formula C16H13F4N5O5 and a molecular weight of 431.30 g/mol. Its IUPAC name is 2-[5-[3-[3-[5-fluoro-2-(trifluoromethyl)phenoxy]propoxy]-1,2-oxazol-5-yl]tetrazol-2-yl]acetic acid.
| Compound Name | 2-[5-[3-[3-[5-fluoro-2-(trifluoromethyl)phenoxy]propoxy]-1,2-oxazol-5-yl]tetrazol-2-yl]acetic acid |
|---|---|
| PubChem CID | 59321691 |
| Molecular Formula | C16H13F4N5O5 |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 2-[5-[3-[3-[5-fluoro-2-(trifluoromethyl)phenoxy]propoxy]-1,2-oxazol-5-yl]tetrazol-2-yl]acetic acid |
| SMILES | O=C(O)Cn1nnc(-c2cc(OCCCOc3cc(F)ccc3C(F)(F)F)no2)n1 |
| InChI | InChI=1S/C16H13F4N5O5/c17-9-2-3-10(16(18,19)20)11(6-9)28-4-1-5-29-13-7-12(30-23-13)15-21-24-25(22-15)8-14(26)27/h2-3,6-7H,1,4-5,8H2,(H,26,27) |
| InChIKey | WKFNPQUYMBXQFU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 125.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|