C29H32N6O2S — CID 59322479
(E)-4-(dimethylamino)-1-[3-[[(1S)-1-phenyl-2-(pyridin-2-ylmethoxy)ethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one (PubChem CID 59322479) has the molecular formula C29H32N6O2S and a molecular weight of 528.68 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-1-[3-[[(1S)-1-phenyl-2-(pyridin-2-ylmethoxy)ethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one.
| Compound Name | (E)-4-(dimethylamino)-1-[3-[[(1S)-1-phenyl-2-(pyridin-2-ylmethoxy)ethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 59322479 |
| Molecular Formula | C29H32N6O2S |
| Molecular Weight | 528.68 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | (E)-4-(dimethylamino)-1-[3-[[(1S)-1-phenyl-2-(pyridin-2-ylmethoxy)ethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
| SMILES | CN(C)C/C=C/C(=O)N1CCc2c(sc3ncnc(N[C@H](COCc4ccccn4)c4ccccc4)c23)C1 |
| InChI | InChI=1S/C29H32N6O2S/c1-34(2)15-8-12-26(36)35-16-13-23-25(17-35)38-29-27(23)28(31-20-32-29)33-24(21-9-4-3-5-10-21)19-37-18-22-11-6-7-14-30-22/h3-12,14,20,24H,13,15-19H2,1-2H3,(H,31,32,33)/b12-8+/t24-/m1/s1 |
| InChIKey | JBPBPERILBAJRU-ZXXUSRDYSA-N |
| XLogP | 4.46 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.68 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|