C34H30F2N4O2S — CID 59322528
1-[3-[[(1S)-2-[(3-fluorophenyl)methoxy]-1-phenylethyl]-[(3-fluorophenyl)methyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]prop-2-en-1-one (PubChem CID 59322528) has the molecular formula C34H30F2N4O2S and a molecular weight of 596.70 g/mol. Its IUPAC name is 1-[3-[[(1S)-2-[(3-fluorophenyl)methoxy]-1-phenylethyl]-[(3-fluorophenyl)methyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[[(1S)-2-[(3-fluorophenyl)methoxy]-1-phenylethyl]-[(3-fluorophenyl)methyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 59322528 |
| Molecular Formula | C34H30F2N4O2S |
| Molecular Weight | 596.70 g/mol |
| Exact Mass | 596.21 |
| IUPAC Name | 1-[3-[[(1S)-2-[(3-fluorophenyl)methoxy]-1-phenylethyl]-[(3-fluorophenyl)methyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCc2c(sc3ncnc(N(Cc4cccc(F)c4)[C@H](COCc4cccc(F)c4)c4ccccc4)c23)C1 |
| InChI | InChI=1S/C34H30F2N4O2S/c1-2-31(41)39-15-14-28-30(19-39)43-34-32(28)33(37-22-38-34)40(18-23-8-6-12-26(35)16-23)29(25-10-4-3-5-11-25)21-42-20-24-9-7-13-27(36)17-24/h2-13,16-17,22,29H,1,14-15,18-21H2/t29-/m1/s1 |
| InChIKey | KJOCWUKEMUSFFG-GDLZYMKVSA-N |
| XLogP | 7.00 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.70 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|