C28H27FN4O2S — CID 59322531
(E)-1-[3-[[(1S)-2-[(3-fluorophenyl)methoxy]-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one (PubChem CID 59322531) has the molecular formula C28H27FN4O2S and a molecular weight of 502.62 g/mol. Its IUPAC name is (E)-1-[3-[[(1S)-2-[(3-fluorophenyl)methoxy]-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one.
| Compound Name | (E)-1-[3-[[(1S)-2-[(3-fluorophenyl)methoxy]-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 59322531 |
| Molecular Formula | C28H27FN4O2S |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | (E)-1-[3-[[(1S)-2-[(3-fluorophenyl)methoxy]-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
| SMILES | C/C=C/C(=O)N1CCc2c(sc3ncnc(N[C@H](COCc4cccc(F)c4)c4ccccc4)c23)C1 |
| InChI | InChI=1S/C28H27FN4O2S/c1-2-7-25(34)33-13-12-22-24(15-33)36-28-26(22)27(30-18-31-28)32-23(20-9-4-3-5-10-20)17-35-16-19-8-6-11-21(29)14-19/h2-11,14,18,23H,12-13,15-17H2,1H3,(H,30,31,32)/b7-2+/t23-/m1/s1 |
| InChIKey | RPUDTQBUSUPNNN-KRXBKFNPSA-N |
| XLogP | 5.66 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|