C26H34N4O2SSi — CID 59322533
1-[3-[[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]prop-2-en-1-one (PubChem CID 59322533) has the molecular formula C26H34N4O2SSi and a molecular weight of 494.74 g/mol. Its IUPAC name is 1-[3-[[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 59322533 |
| Molecular Formula | C26H34N4O2SSi |
| Molecular Weight | 494.74 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 1-[3-[[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCc2c(sc3ncnc(N[C@@H](CO[Si](C)(C)C(C)(C)C)c4ccccc4)c23)C1 |
| InChI | InChI=1S/C26H34N4O2SSi/c1-7-22(31)30-14-13-19-21(15-30)33-25-23(19)24(27-17-28-25)29-20(18-11-9-8-10-12-18)16-32-34(5,6)26(2,3)4/h7-12,17,20H,1,13-16H2,2-6H3,(H,27,28,29)/t20-/m0/s1 |
| InChIKey | VRIVXSQJJNNLHW-FQEVSTJZSA-N |
| XLogP | 5.94 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.74 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|