C23H22N4O5S — CID 59322560
(2S)-2-[[11-[(E)-4-ethoxy-4-oxobut-2-enoyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]amino]-2-phenylacetic acid (PubChem CID 59322560) has the molecular formula C23H22N4O5S and a molecular weight of 466.52 g/mol. Its IUPAC name is (2S)-2-[[11-[(E)-4-ethoxy-4-oxobut-2-enoyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]amino]-2-phenylacetic acid.
| Compound Name | (2S)-2-[[11-[(E)-4-ethoxy-4-oxobut-2-enoyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 59322560 |
| Molecular Formula | C23H22N4O5S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | (2S)-2-[[11-[(E)-4-ethoxy-4-oxobut-2-enoyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]amino]-2-phenylacetic acid |
| SMILES | CCOC(=O)/C=C/C(=O)N1CCc2c(sc3ncnc(N[C@H](C(=O)O)c4ccccc4)c23)C1 |
| InChI | InChI=1S/C23H22N4O5S/c1-2-32-18(29)9-8-17(28)27-11-10-15-16(12-27)33-22-19(15)21(24-13-25-22)26-20(23(30)31)14-6-4-3-5-7-14/h3-9,13,20H,2,10-12H2,1H3,(H,30,31)(H,24,25,26)/b9-8+/t20-/m0/s1 |
| InChIKey | OPSGTDJWMBXIOZ-IBDYFIJFSA-N |
| XLogP | 2.93 |
| TPSA | 121.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|