C21H22N4O2S — CID 59322570
1-[3-[[(1S)-2-hydroxy-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-2-methylprop-2-en-1-one (PubChem CID 59322570) has the molecular formula C21H22N4O2S and a molecular weight of 394.50 g/mol. Its IUPAC name is 1-[3-[[(1S)-2-hydroxy-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-2-methylprop-2-en-1-one.
| Compound Name | 1-[3-[[(1S)-2-hydroxy-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-2-methylprop-2-en-1-one |
|---|---|
| PubChem CID | 59322570 |
| Molecular Formula | C21H22N4O2S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 1-[3-[[(1S)-2-hydroxy-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-2-methylprop-2-en-1-one |
| SMILES | C=C(C)C(=O)N1CCc2c(sc3ncnc(N[C@H](CO)c4ccccc4)c23)C1 |
| InChI | InChI=1S/C21H22N4O2S/c1-13(2)21(27)25-9-8-15-17(10-25)28-20-18(15)19(22-12-23-20)24-16(11-26)14-6-4-3-5-7-14/h3-7,12,16,26H,1,8-11H2,2H3,(H,22,23,24)/t16-/m1/s1 |
| InChIKey | WHQRUCICODVRQX-MRXNPFEDSA-N |
| XLogP | 3.30 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|