C23H23F4N5O2S — CID 59322581
(E)-4-(dimethylamino)-1-[10,10,12,12-tetrafluoro-3-[[(1S)-2-hydroxy-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one (PubChem CID 59322581) has the molecular formula C23H23F4N5O2S and a molecular weight of 509.53 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-1-[10,10,12,12-tetrafluoro-3-[[(1S)-2-hydroxy-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one.
| Compound Name | (E)-4-(dimethylamino)-1-[10,10,12,12-tetrafluoro-3-[[(1S)-2-hydroxy-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 59322581 |
| Molecular Formula | C23H23F4N5O2S |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | (E)-4-(dimethylamino)-1-[10,10,12,12-tetrafluoro-3-[[(1S)-2-hydroxy-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
| SMILES | CN(C)C/C=C/C(=O)N1C(F)(F)Cc2c(sc3ncnc(N[C@H](CO)c4ccccc4)c23)C1(F)F |
| InChI | InChI=1S/C23H23F4N5O2S/c1-31(2)10-6-9-17(34)32-22(24,25)11-15-18-20(30-16(12-33)14-7-4-3-5-8-14)28-13-29-21(18)35-19(15)23(32,26)27/h3-9,13,16,33H,10-12H2,1-2H3,(H,28,29,30)/b9-6+/t16-/m1/s1 |
| InChIKey | SYOQIDNEEDLRCB-YXMGTMDOSA-N |
| XLogP | 3.98 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|