C23H24N4O3S — CID 59322646
[(E)-4-oxo-4-[3-[[(1R)-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-enyl] acetate (PubChem CID 59322646) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is [(E)-4-oxo-4-[3-[[(1R)-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-enyl] acetate.
| Compound Name | [(E)-4-oxo-4-[3-[[(1R)-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-enyl] acetate |
|---|---|
| PubChem CID | 59322646 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | [(E)-4-oxo-4-[3-[[(1R)-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C/C(=O)N1CCc2c(sc3ncnc(N[C@H](C)c4ccccc4)c23)C1 |
| InChI | InChI=1S/C23H24N4O3S/c1-15(17-7-4-3-5-8-17)26-22-21-18-10-11-27(20(29)9-6-12-30-16(2)28)13-19(18)31-23(21)25-14-24-22/h3-9,14-15H,10-13H2,1-2H3,(H,24,25,26)/b9-6+/t15-/m1/s1 |
| InChIKey | ZZXAAEJRBXUQGY-RZIFZGNASA-N |
| XLogP | 3.87 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|