C32H33N5O2S — CID 59322648
5-[(E)-4-(dimethylamino)but-2-enoyl]-13-[[(1S)-1-phenyl-2-phenylmethoxyethyl]amino]-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-12-carbonitrile (PubChem CID 59322648) has the molecular formula C32H33N5O2S and a molecular weight of 551.72 g/mol. Its IUPAC name is 5-[(E)-4-(dimethylamino)but-2-enoyl]-13-[[(1S)-1-phenyl-2-phenylmethoxyethyl]amino]-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-12-carbonitrile.
| Compound Name | 5-[(E)-4-(dimethylamino)but-2-enoyl]-13-[[(1S)-1-phenyl-2-phenylmethoxyethyl]amino]-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-12-carbonitrile |
|---|---|
| PubChem CID | 59322648 |
| Molecular Formula | C32H33N5O2S |
| Molecular Weight | 551.72 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | 5-[(E)-4-(dimethylamino)but-2-enoyl]-13-[[(1S)-1-phenyl-2-phenylmethoxyethyl]amino]-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-12-carbonitrile |
| SMILES | CN(C)C/C=C/C(=O)N1CCc2c(sc3ncc(C#N)c(N[C@H](COCc4ccccc4)c4ccccc4)c23)C1 |
| InChI | InChI=1S/C32H33N5O2S/c1-36(2)16-9-14-29(38)37-17-15-26-28(20-37)40-32-30(26)31(25(18-33)19-34-32)35-27(24-12-7-4-8-13-24)22-39-21-23-10-5-3-6-11-23/h3-14,19,27H,15-17,20-22H2,1-2H3,(H,34,35)/b14-9+/t27-/m1/s1 |
| InChIKey | VKVOKFVEPKKFKS-WKMZLRSWSA-N |
| XLogP | 5.54 |
| TPSA | 81.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.72 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|