C31H34FN5O2S — CID 59322665
(E)-4-(dimethylamino)-1-[3-[[(1R)-3-[(2-fluorophenyl)methoxy]-1-phenylpropyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one (PubChem CID 59322665) has the molecular formula C31H34FN5O2S and a molecular weight of 559.71 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-1-[3-[[(1R)-3-[(2-fluorophenyl)methoxy]-1-phenylpropyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one.
| Compound Name | (E)-4-(dimethylamino)-1-[3-[[(1R)-3-[(2-fluorophenyl)methoxy]-1-phenylpropyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 59322665 |
| Molecular Formula | C31H34FN5O2S |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | (E)-4-(dimethylamino)-1-[3-[[(1R)-3-[(2-fluorophenyl)methoxy]-1-phenylpropyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
| SMILES | CN(C)C/C=C/C(=O)N1CCc2c(sc3ncnc(N[C@H](CCOCc4ccccc4F)c4ccccc4)c23)C1 |
| InChI | InChI=1S/C31H34FN5O2S/c1-36(2)16-8-13-28(38)37-17-14-24-27(19-37)40-31-29(24)30(33-21-34-31)35-26(22-9-4-3-5-10-22)15-18-39-20-23-11-6-7-12-25(23)32/h3-13,21,26H,14-20H2,1-2H3,(H,33,34,35)/b13-8+/t26-/m1/s1 |
| InChIKey | FMTWWXWMOUJCTE-PVBLUSGHSA-N |
| XLogP | 5.59 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|