C27H29F2N3O2 — CID 59323219
1-[3-[6-fluoro-3-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]propyl]-3-(3-methoxyphenyl)urea (PubChem CID 59323219) has the molecular formula C27H29F2N3O2 and a molecular weight of 465.54 g/mol. Its IUPAC name is 1-[3-[6-fluoro-3-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]propyl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[3-[6-fluoro-3-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]propyl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 59323219 |
| Molecular Formula | C27H29F2N3O2 |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 1-[3-[6-fluoro-3-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]propyl]-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)NCCCN2Cc3ccc(F)cc3CC2Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C27H29F2N3O2/c1-34-26-5-2-4-24(17-26)31-27(33)30-12-3-13-32-18-20-8-11-23(29)15-21(20)16-25(32)14-19-6-9-22(28)10-7-19/h2,4-11,15,17,25H,3,12-14,16,18H2,1H3,(H2,30,31,33) |
| InChIKey | ZXKRGRFJYVXGME-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|