About (4R)-2,2-diethyl-8-(trifluoromethyl)-3,4-dihydrochromen-4-amine
(4R)-2,2-diethyl-8-(trifluoromethyl)-3,4-dihydrochromen-4-amine (PubChem CID 59323480) has the molecular formula C14H18F3NO
and a molecular weight of 273.30 g/mol. Its IUPAC name is (4R)-2,2-diethyl-8-(trifluoromethyl)-3,4-dihydrochromen-4-amine.
Molecular Properties
| Compound Name | (4R)-2,2-diethyl-8-(trifluoromethyl)-3,4-dihydrochromen-4-amine |
| PubChem CID | 59323480 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | (4R)-2,2-diethyl-8-(trifluoromethyl)-3,4-dihydrochromen-4-amine |
| SMILES | CCC1(CC)C[C@@H](N)c2cccc(C(F)(F)F)c2O1 |
| InChI | InChI=1S/C14H18F3NO/c1-3-13(4-2)8-11(18)9-6-5-7-10(12(9)19-13)14(15,16)17/h5-7,11H,3-4,8,18H2,1-2H3/t11-/m1/s1 |
| InChIKey | RFMMFDRRXOTLSC-LLVKDONJSA-N |
| XLogP | 4.05 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-2,2-diethyl-8-(trifluoromethyl)-3,4-dihydrochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2,2-diethyl-8-(trifluoromethyl)-3,4-dihydrochromen-4-amine?
The IUPAC name of (4R)-2,2-diethyl-8-(trifluoromethyl)-3,4-dihydrochromen-4-amine (CID 59323480) is (4R)-2,2-diethyl-8-(trifluoromethyl)-3,4-dihydrochromen-4-amine.
What is the SMILES notation for (4R)-2,2-diethyl-8-(trifluoromethyl)-3,4-dihydrochromen-4-amine?
The canonical SMILES for (4R)-2,2-diethyl-8-(trifluoromethyl)-3,4-dihydrochromen-4-amine is CCC1(CC)C[C@@H](N)c2cccc(C(F)(F)F)c2O1.
What is the InChIKey of (4R)-2,2-diethyl-8-(trifluoromethyl)-3,4-dihydrochromen-4-amine?
The InChIKey is RFMMFDRRXOTLSC-LLVKDONJSA-N. The full InChI is InChI=1S/C14H18F3NO/c1-3-13(4-2)8-11(18)9-6-5-7-10(12(9)19-13)14(15,16)17/h5-7,11H,3-4,8,18H2,1-2H3/t11-/m1/s1.
What are the key properties of (4R)-2,2-diethyl-8-(trifluoromethyl)-3,4-dihydrochromen-4-amine?
(4R)-2,2-diethyl-8-(trifluoromethyl)-3,4-dihydrochromen-4-amine has a molecular weight of 273.30 g/mol, XLogP of 4.05, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2,2-diethyl-8-(trifluoromethyl)-3,4-dihydrochromen-4-amine is sourced from PubChem (CID 59323480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).