C22H17N5 — CID 59323496
6-isocyano-4-[2-(6-methyl-2-pyridinyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]quinoline (PubChem CID 59323496) has the molecular formula C22H17N5 and a molecular weight of 351.41 g/mol. Its IUPAC name is 6-isocyano-4-[2-(6-methyl-2-pyridinyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]quinoline.
| Compound Name | 6-isocyano-4-[2-(6-methyl-2-pyridinyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]quinoline |
|---|---|
| PubChem CID | 59323496 |
| Molecular Formula | C22H17N5 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 6-isocyano-4-[2-(6-methyl-2-pyridinyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]quinoline |
| SMILES | [C-]#[N+]c1ccc2nccc(-c3c(-c4cccc(C)n4)nn4c3CCC4)c2c1 |
| InChI | InChI=1S/C22H17N5/c1-14-5-3-6-19(25-14)22-21(20-7-4-12-27(20)26-22)16-10-11-24-18-9-8-15(23-2)13-17(16)18/h3,5-6,8-11,13H,4,7,12H2,1H3 |
| InChIKey | GAKYTPYZXMUQHQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 47.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|