C9H8Cl2N2O — CID 59323718
4-(2,4-dichlorophenyl)-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 59323718) has the molecular formula C9H8Cl2N2O and a molecular weight of 231.08 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | 4-(2,4-dichlorophenyl)-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 59323718 |
| Molecular Formula | C9H8Cl2N2O |
| Molecular Weight | 231.08 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | NC1=NC(c2ccc(Cl)cc2Cl)CO1 |
| InChI | InChI=1S/C9H8Cl2N2O/c10-5-1-2-6(7(11)3-5)8-4-14-9(12)13-8/h1-3,8H,4H2,(H2,12,13) |
| InChIKey | SWHZEDSONXTABY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.08 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |