C10H9F3N2O — CID 59323769
(4S)-4-methyl-4-(3,4,5-trifluorophenyl)-5H-1,3-oxazol-2-amine (PubChem CID 59323769) has the molecular formula C10H9F3N2O and a molecular weight of 230.19 g/mol. Its IUPAC name is (4S)-4-methyl-4-(3,4,5-trifluorophenyl)-5H-1,3-oxazol-2-amine.
| Compound Name | (4S)-4-methyl-4-(3,4,5-trifluorophenyl)-5H-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 59323769 |
| Molecular Formula | C10H9F3N2O |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | (4S)-4-methyl-4-(3,4,5-trifluorophenyl)-5H-1,3-oxazol-2-amine |
| SMILES | C[C@]1(c2cc(F)c(F)c(F)c2)COC(N)=N1 |
| InChI | InChI=1S/C10H9F3N2O/c1-10(4-16-9(14)15-10)5-2-6(11)8(13)7(12)3-5/h2-3H,4H2,1H3,(H2,14,15)/t10-/m1/s1 |
| InChIKey | BKWLTLWYHNRYMM-SNVBAGLBSA-N |
| XLogP | 1.66 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|