C11H13ClN2O — CID 59323794
(4S)-4-(4-chloro-2-ethylphenyl)-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 59323794) has the molecular formula C11H13ClN2O and a molecular weight of 224.69 g/mol. Its IUPAC name is (4S)-4-(4-chloro-2-ethylphenyl)-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | (4S)-4-(4-chloro-2-ethylphenyl)-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 59323794 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | (4S)-4-(4-chloro-2-ethylphenyl)-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | CCc1cc(Cl)ccc1[C@H]1COC(N)=N1 |
| InChI | InChI=1S/C11H13ClN2O/c1-2-7-5-8(12)3-4-9(7)10-6-15-11(13)14-10/h3-5,10H,2,6H2,1H3,(H2,13,14)/t10-/m1/s1 |
| InChIKey | QMJCJXYDQQSDCX-SNVBAGLBSA-N |
| XLogP | 2.29 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |