C21H24F4N4O — CID 59324165
1,1,1-trifluoro-2-[[[1-(4-fluorophenyl)-6-methylindazol-4-yl]amino]methyl]-3-(propylamino)propan-2-ol (PubChem CID 59324165) has the molecular formula C21H24F4N4O and a molecular weight of 424.44 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[[[1-(4-fluorophenyl)-6-methylindazol-4-yl]amino]methyl]-3-(propylamino)propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-[[[1-(4-fluorophenyl)-6-methylindazol-4-yl]amino]methyl]-3-(propylamino)propan-2-ol |
|---|---|
| PubChem CID | 59324165 |
| Molecular Formula | C21H24F4N4O |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 1,1,1-trifluoro-2-[[[1-(4-fluorophenyl)-6-methylindazol-4-yl]amino]methyl]-3-(propylamino)propan-2-ol |
| SMILES | CCCNCC(O)(CNc1cc(C)cc2c1cnn2-c1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C21H24F4N4O/c1-3-8-26-12-20(30,21(23,24)25)13-27-18-9-14(2)10-19-17(18)11-28-29(19)16-6-4-15(22)5-7-16/h4-7,9-11,26-27,30H,3,8,12-13H2,1-2H3 |
| InChIKey | XLUUIDAYJYBSPO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|