C6F8 — CID 593242
1,2,3,4,5,5,6,6-octafluorocyclohexa-1,3-diene (PubChem CID 593242) has the molecular formula C6F8 and a molecular weight of 224.05 g/mol. Its IUPAC name is 1,2,3,4,5,5,6,6-octafluorocyclohexa-1,3-diene.
| Compound Name | 1,2,3,4,5,5,6,6-octafluorocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 593242 |
| Molecular Formula | C6F8 |
| Molecular Weight | 224.05 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | 1,2,3,4,5,5,6,6-octafluorocyclohexa-1,3-diene |
| SMILES | FC1=C(F)C(F)(F)C(F)(F)C(F)=C1F |
| InChI | InChI=1S/C6F8/c7-1-2(8)4(10)6(13,14)5(11,12)3(1)9 |
| InChIKey | NYEZNHLGLOQHEE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.05 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|