C26H23F3N6O — CID 59325513
6-ethynyl-N-[3-(1-methylpyrazol-4-yl)-5-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]oxyphenyl]quinazolin-2-amine (PubChem CID 59325513) has the molecular formula C26H23F3N6O and a molecular weight of 492.51 g/mol. Its IUPAC name is 6-ethynyl-N-[3-(1-methylpyrazol-4-yl)-5-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]oxyphenyl]quinazolin-2-amine.
| Compound Name | 6-ethynyl-N-[3-(1-methylpyrazol-4-yl)-5-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]oxyphenyl]quinazolin-2-amine |
|---|---|
| PubChem CID | 59325513 |
| Molecular Formula | C26H23F3N6O |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 6-ethynyl-N-[3-(1-methylpyrazol-4-yl)-5-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]oxyphenyl]quinazolin-2-amine |
| SMILES | C#Cc1ccc2nc(Nc3cc(OC4CCN(CC(F)(F)F)C4)cc(-c4cnn(C)c4)c3)ncc2c1 |
| InChI | InChI=1S/C26H23F3N6O/c1-3-17-4-5-24-19(8-17)12-30-25(33-24)32-21-9-18(20-13-31-34(2)14-20)10-23(11-21)36-22-6-7-35(15-22)16-26(27,28)29/h1,4-5,8-14,22H,6-7,15-16H2,2H3,(H,30,32,33) |
| InChIKey | JXNLEILIIVVARR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|