C26H24N6O3 — CID 59325595
methyl (2S,4S)-4-[3-[(6-ethynylquinazolin-2-yl)amino]-5-(1-methylpyrazol-4-yl)phenoxy]pyrrolidine-2-carboxylate (PubChem CID 59325595) has the molecular formula C26H24N6O3 and a molecular weight of 468.52 g/mol. Its IUPAC name is methyl (2S,4S)-4-[3-[(6-ethynylquinazolin-2-yl)amino]-5-(1-methylpyrazol-4-yl)phenoxy]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S)-4-[3-[(6-ethynylquinazolin-2-yl)amino]-5-(1-methylpyrazol-4-yl)phenoxy]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 59325595 |
| Molecular Formula | C26H24N6O3 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | methyl (2S,4S)-4-[3-[(6-ethynylquinazolin-2-yl)amino]-5-(1-methylpyrazol-4-yl)phenoxy]pyrrolidine-2-carboxylate |
| SMILES | C#Cc1ccc2nc(Nc3cc(O[C@@H]4CN[C@H](C(=O)OC)C4)cc(-c4cnn(C)c4)c3)ncc2c1 |
| InChI | InChI=1S/C26H24N6O3/c1-4-16-5-6-23-18(7-16)12-28-26(31-23)30-20-8-17(19-13-29-32(2)15-19)9-21(10-20)35-22-11-24(27-14-22)25(33)34-3/h1,5-10,12-13,15,22,24,27H,11,14H2,2-3H3,(H,28,30,31)/t22-,24-/m0/s1 |
| InChIKey | DEOZCGCIDJWZLT-UPVQGACJSA-N |
| XLogP | 3.04 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|