C15H28O6P- — CID 59325781
[(2S,7R)-2-methyl-7-propan-2-yloxy-3,4,5,6,7,7a-hexahydro-2H-1-benzofuran-3a-yl] propan-2-yl phosphate (PubChem CID 59325781) has the molecular formula C15H28O6P- and a molecular weight of 335.36 g/mol. Its IUPAC name is [(2S,7R)-2-methyl-7-propan-2-yloxy-3,4,5,6,7,7a-hexahydro-2H-1-benzofuran-3a-yl] propan-2-yl phosphate.
| Compound Name | [(2S,7R)-2-methyl-7-propan-2-yloxy-3,4,5,6,7,7a-hexahydro-2H-1-benzofuran-3a-yl] propan-2-yl phosphate |
|---|---|
| PubChem CID | 59325781 |
| Molecular Formula | C15H28O6P- |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | [(2S,7R)-2-methyl-7-propan-2-yloxy-3,4,5,6,7,7a-hexahydro-2H-1-benzofuran-3a-yl] propan-2-yl phosphate |
| SMILES | CC(C)O[C@@H]1CCCC2(OP(=O)([O-])OC(C)C)C[C@H](C)OC12 |
| InChI | InChI=1S/C15H29O6P/c1-10(2)18-13-7-6-8-15(9-12(5)19-14(13)15)21-22(16,17)20-11(3)4/h10-14H,6-9H2,1-5H3,(H,16,17)/p-1/t12-,13+,14?,15?/m0/s1 |
| InChIKey | HIWWEOOYRHIFCJ-ZUJMUWTESA-M |
| XLogP | 2.79 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|