About 4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-amine
4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-amine (PubChem CID 59325835) has the molecular formula C6H9N3O
and a molecular weight of 139.16 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-amine.
Analyze 4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-amine?
The IUPAC name of 4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-amine (CID 59325835) is 4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-amine.
What is the SMILES notation for 4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-amine?
The canonical SMILES for 4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-amine is Nc1noc2c1CCNC2.
What is the InChIKey of 4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-amine?
The InChIKey is LFTJXSZKOJXNHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O/c7-6-4-1-2-8-3-5(4)10-9-6/h8H,1-3H2,(H2,7,9).
What are the key properties of 4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-amine?
4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-amine has a molecular weight of 139.16 g/mol, XLogP of -0.10, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-amine is sourced from PubChem (CID 59325835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).