C10H20N3O+ — CID 59325846
4-(1,3-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-yl)morpholine (PubChem CID 59325846) has the molecular formula C10H20N3O+ and a molecular weight of 198.29 g/mol. Its IUPAC name is 4-(1,3-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-yl)morpholine.
| Compound Name | 4-(1,3-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-yl)morpholine |
|---|---|
| PubChem CID | 59325846 |
| Molecular Formula | C10H20N3O+ |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 4-(1,3-dimethyl-5,6-dihydro-4H-pyrimidin-1-ium-2-yl)morpholine |
| SMILES | CN1CCC[N+](C)=C1N1CCOCC1 |
| InChI | InChI=1S/C10H20N3O/c1-11-4-3-5-12(2)10(11)13-6-8-14-9-7-13/h3-9H2,1-2H3/q+1 |
| InChIKey | XHHOLWJWHHKCJJ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 18.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|