C25H29F3N3O8S- — CID 59326261
N-[3-ethoxycarbonyloxy-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]-2,2,2-trifluoroethanimidate (PubChem CID 59326261) has the molecular formula C25H29F3N3O8S- and a molecular weight of 588.58 g/mol. Its IUPAC name is N-[3-ethoxycarbonyloxy-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]-2,2,2-trifluoroethanimidate.
| Compound Name | N-[3-ethoxycarbonyloxy-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]-2,2,2-trifluoroethanimidate |
|---|---|
| PubChem CID | 59326261 |
| Molecular Formula | C25H29F3N3O8S- |
| Molecular Weight | 588.58 g/mol |
| Exact Mass | 588.16 |
| IUPAC Name | N-[3-ethoxycarbonyloxy-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]-2,2,2-trifluoroethanimidate |
| SMILES | CCOC(=O)OC(CN(CC(C)C)S(=O)(=O)c1ccc([N+](=O)[O-])cc1)C(Cc1ccccc1)/N=C(\[O-])C(F)(F)F |
| InChI | InChI=1S/C25H30F3N3O8S/c1-4-38-24(33)39-22(21(29-23(32)25(26,27)28)14-18-8-6-5-7-9-18)16-30(15-17(2)3)40(36,37)20-12-10-19(11-13-20)31(34)35/h5-13,17,21-22H,4,14-16H2,1-3H3,(H,29,32)/p-1 |
| InChIKey | ODOWMDBQVVZMMG-UHFFFAOYSA-M |
| XLogP | 3.72 |
| TPSA | 151.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.58 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|