N-(2-fluoroethylsulfonyl)sulfamoyl fluoride

C2H5F2NO4S2 — CID 59326372

IUPACN-(2-fluoroethylsulfonyl)sulfamoyl fluoride
SMILESO=S(=O)(F)NS(=O)(=O)CCF
InChIInChI=1S/C2H5F2NO4S2/c3-1-2-10(6,7)5-11(4,8)9/h5H,1-2H2
InChIKeyPXBDJORZJXZSFC-UHFFFAOYSA-N
MW209.19 g/mol
LogP-0.91
Rot. Bonds4

About N-(2-fluoroethylsulfonyl)sulfamoyl fluoride

N-(2-fluoroethylsulfonyl)sulfamoyl fluoride (PubChem CID 59326372) has the molecular formula C2H5F2NO4S2 and a molecular weight of 209.19 g/mol. Its IUPAC name is N-(2-fluoroethylsulfonyl)sulfamoyl fluoride.

Molecular Properties

Compound NameN-(2-fluoroethylsulfonyl)sulfamoyl fluoride
PubChem CID59326372
Molecular FormulaC2H5F2NO4S2
Molecular Weight209.19 g/mol
Exact Mass208.96
IUPAC NameN-(2-fluoroethylsulfonyl)sulfamoyl fluoride
SMILESO=S(=O)(F)NS(=O)(=O)CCF
InChIInChI=1S/C2H5F2NO4S2/c3-1-2-10(6,7)5-11(4,8)9/h5H,1-2H2
InChIKeyPXBDJORZJXZSFC-UHFFFAOYSA-N
XLogP-0.91
TPSA80.31 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.19
LogP ≤ 5-0.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze N-(2-fluoroethylsulfonyl)sulfamoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(2-fluoroethylsulfonyl)sulfamoyl fluoride?
The IUPAC name of N-(2-fluoroethylsulfonyl)sulfamoyl fluoride (CID 59326372) is N-(2-fluoroethylsulfonyl)sulfamoyl fluoride.
What is the SMILES notation for N-(2-fluoroethylsulfonyl)sulfamoyl fluoride?
The canonical SMILES for N-(2-fluoroethylsulfonyl)sulfamoyl fluoride is O=S(=O)(F)NS(=O)(=O)CCF.
What is the InChIKey of N-(2-fluoroethylsulfonyl)sulfamoyl fluoride?
The InChIKey is PXBDJORZJXZSFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5F2NO4S2/c3-1-2-10(6,7)5-11(4,8)9/h5H,1-2H2.
What are the key properties of N-(2-fluoroethylsulfonyl)sulfamoyl fluoride?
N-(2-fluoroethylsulfonyl)sulfamoyl fluoride has a molecular weight of 209.19 g/mol, XLogP of -0.91, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluoroethylsulfonyl)sulfamoyl fluoride is sourced from PubChem (CID 59326372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).