C18H12O6 — CID 59326459
2,3,6,7-tetramethylanthracene-1,4,5,8,9,10-hexone (PubChem CID 59326459) has the molecular formula C18H12O6 and a molecular weight of 324.29 g/mol. Its IUPAC name is 2,3,6,7-tetramethylanthracene-1,4,5,8,9,10-hexone.
| Compound Name | 2,3,6,7-tetramethylanthracene-1,4,5,8,9,10-hexone |
|---|---|
| PubChem CID | 59326459 |
| Molecular Formula | C18H12O6 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 2,3,6,7-tetramethylanthracene-1,4,5,8,9,10-hexone |
| SMILES | Cc1c(C)c(=O)c2c(=O)c3c(=O)c(C)c(C)c(=O)c3c(=O)c2c1=O |
| InChI | InChI=1S/C18H12O6/c1-5-6(2)14(20)10-9(13(5)19)17(23)11-12(18(10)24)16(22)8(4)7(3)15(11)21/h1-4H3 |
| InChIKey | ZYGHLOFKUXTAEM-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|