About 1H-imidazo[4,5-b]pyridin-2-yl-[4-[[3-(oxan-4-yl)-2-pyridinyl]oxy]phenyl]methanone
1H-imidazo[4,5-b]pyridin-2-yl-[4-[[3-(oxan-4-yl)-2-pyridinyl]oxy]phenyl]methanone (PubChem CID 59326806) has the molecular formula C23H20N4O3
and a molecular weight of 400.44 g/mol. Its IUPAC name is 1H-imidazo[4,5-b]pyridin-2-yl-[4-[[3-(oxan-4-yl)-2-pyridinyl]oxy]phenyl]methanone.
Molecular Properties
| Compound Name | 1H-imidazo[4,5-b]pyridin-2-yl-[4-[[3-(oxan-4-yl)-2-pyridinyl]oxy]phenyl]methanone |
| PubChem CID | 59326806 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 1H-imidazo[4,5-b]pyridin-2-yl-[4-[[3-(oxan-4-yl)-2-pyridinyl]oxy]phenyl]methanone |
| SMILES | O=C(c1ccc(Oc2ncccc2C2CCOCC2)cc1)c1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C23H20N4O3/c28-20(22-26-19-4-2-11-24-21(19)27-22)16-5-7-17(8-6-16)30-23-18(3-1-12-25-23)15-9-13-29-14-10-15/h1-8,11-12,15H,9-10,13-14H2,(H,24,26,27) |
| InChIKey | DDZBKMLSDGQNMB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1H-imidazo[4,5-b]pyridin-2-yl-[4-[[3-(oxan-4-yl)-2-pyridinyl]oxy]phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazo[4,5-b]pyridin-2-yl-[4-[[3-(oxan-4-yl)-2-pyridinyl]oxy]phenyl]methanone?
The IUPAC name of 1H-imidazo[4,5-b]pyridin-2-yl-[4-[[3-(oxan-4-yl)-2-pyridinyl]oxy]phenyl]methanone (CID 59326806) is 1H-imidazo[4,5-b]pyridin-2-yl-[4-[[3-(oxan-4-yl)-2-pyridinyl]oxy]phenyl]methanone.
What is the SMILES notation for 1H-imidazo[4,5-b]pyridin-2-yl-[4-[[3-(oxan-4-yl)-2-pyridinyl]oxy]phenyl]methanone?
The canonical SMILES for 1H-imidazo[4,5-b]pyridin-2-yl-[4-[[3-(oxan-4-yl)-2-pyridinyl]oxy]phenyl]methanone is O=C(c1ccc(Oc2ncccc2C2CCOCC2)cc1)c1nc2ncccc2[nH]1.
What is the InChIKey of 1H-imidazo[4,5-b]pyridin-2-yl-[4-[[3-(oxan-4-yl)-2-pyridinyl]oxy]phenyl]methanone?
The InChIKey is DDZBKMLSDGQNMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N4O3/c28-20(22-26-19-4-2-11-24-21(19)27-22)16-5-7-17(8-6-16)30-23-18(3-1-12-25-23)15-9-13-29-14-10-15/h1-8,11-12,15H,9-10,13-14H2,(H,24,26,27).
What are the key properties of 1H-imidazo[4,5-b]pyridin-2-yl-[4-[[3-(oxan-4-yl)-2-pyridinyl]oxy]phenyl]methanone?
1H-imidazo[4,5-b]pyridin-2-yl-[4-[[3-(oxan-4-yl)-2-pyridinyl]oxy]phenyl]methanone has a molecular weight of 400.44 g/mol, XLogP of 4.27, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazo[4,5-b]pyridin-2-yl-[4-[[3-(oxan-4-yl)-2-pyridinyl]oxy]phenyl]methanone is sourced from PubChem (CID 59326806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).