About 1-[4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]piperidin-1-yl]ethanone
1-[4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]piperidin-1-yl]ethanone (PubChem CID 59326881) has the molecular formula C25H24N4O2S
and a molecular weight of 444.56 g/mol. Its IUPAC name is 1-[4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]piperidin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]piperidin-1-yl]ethanone |
| PubChem CID | 59326881 |
| Molecular Formula | C25H24N4O2S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 1-[4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(c2cccnc2Oc2ccc(Nc3nc4ccccc4s3)cc2)CC1 |
| InChI | InChI=1S/C25H24N4O2S/c1-17(30)29-15-12-18(13-16-29)21-5-4-14-26-24(21)31-20-10-8-19(9-11-20)27-25-28-22-6-2-3-7-23(22)32-25/h2-11,14,18H,12-13,15-16H2,1H3,(H,27,28) |
| InChIKey | OBECUGBNTGJTQH-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]piperidin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]piperidin-1-yl]ethanone?
The IUPAC name of 1-[4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]piperidin-1-yl]ethanone (CID 59326881) is 1-[4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]piperidin-1-yl]ethanone.
What is the SMILES notation for 1-[4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]piperidin-1-yl]ethanone?
The canonical SMILES for 1-[4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]piperidin-1-yl]ethanone is CC(=O)N1CCC(c2cccnc2Oc2ccc(Nc3nc4ccccc4s3)cc2)CC1.
What is the InChIKey of 1-[4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]piperidin-1-yl]ethanone?
The InChIKey is OBECUGBNTGJTQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N4O2S/c1-17(30)29-15-12-18(13-16-29)21-5-4-14-26-24(21)31-20-10-8-19(9-11-20)27-25-28-22-6-2-3-7-23(22)32-25/h2-11,14,18H,12-13,15-16H2,1H3,(H,27,28).
What are the key properties of 1-[4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]piperidin-1-yl]ethanone?
1-[4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]piperidin-1-yl]ethanone has a molecular weight of 444.56 g/mol, XLogP of 5.95, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]piperidin-1-yl]ethanone is sourced from PubChem (CID 59326881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).