About N'-ethenyl-N,N,N'-trimethylpropane-1,3-diamine
N'-ethenyl-N,N,N'-trimethylpropane-1,3-diamine (PubChem CID 59327255) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is N'-ethenyl-N,N,N'-trimethylpropane-1,3-diamine.
Analyze N'-ethenyl-N,N,N'-trimethylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethenyl-N,N,N'-trimethylpropane-1,3-diamine?
The IUPAC name of N'-ethenyl-N,N,N'-trimethylpropane-1,3-diamine (CID 59327255) is N'-ethenyl-N,N,N'-trimethylpropane-1,3-diamine.
What is the SMILES notation for N'-ethenyl-N,N,N'-trimethylpropane-1,3-diamine?
The canonical SMILES for N'-ethenyl-N,N,N'-trimethylpropane-1,3-diamine is C=CN(C)CCCN(C)C.
What is the InChIKey of N'-ethenyl-N,N,N'-trimethylpropane-1,3-diamine?
The InChIKey is CLOZYHCSUMYHID-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2/c1-5-10(4)8-6-7-9(2)3/h5H,1,6-8H2,2-4H3.
What are the key properties of N'-ethenyl-N,N,N'-trimethylpropane-1,3-diamine?
N'-ethenyl-N,N,N'-trimethylpropane-1,3-diamine has a molecular weight of 142.25 g/mol, XLogP of 1.01, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethenyl-N,N,N'-trimethylpropane-1,3-diamine is sourced from PubChem (CID 59327255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).