C18H29NO — CID 59327667
2,2,6,6-tetramethyl-1-(2-phenylpropan-2-yloxy)piperidine (PubChem CID 59327667) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-(2-phenylpropan-2-yloxy)piperidine.
| Compound Name | 2,2,6,6-tetramethyl-1-(2-phenylpropan-2-yloxy)piperidine |
|---|---|
| PubChem CID | 59327667 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-(2-phenylpropan-2-yloxy)piperidine |
| SMILES | CC(C)(ON1C(C)(C)CCCC1(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H29NO/c1-16(2)13-10-14-17(3,4)19(16)20-18(5,6)15-11-8-7-9-12-15/h7-9,11-12H,10,13-14H2,1-6H3 |
| InChIKey | HMVSHELWGDSUJC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |