About N-methyl-N-(2,4,6-trifluorophenyl)naphthalen-1-amine
N-methyl-N-(2,4,6-trifluorophenyl)naphthalen-1-amine (PubChem CID 59327767) has the molecular formula C17H12F3N
and a molecular weight of 287.28 g/mol. Its IUPAC name is N-methyl-N-(2,4,6-trifluorophenyl)naphthalen-1-amine.
Molecular Properties
| Compound Name | N-methyl-N-(2,4,6-trifluorophenyl)naphthalen-1-amine |
| PubChem CID | 59327767 |
| Molecular Formula | C17H12F3N |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | N-methyl-N-(2,4,6-trifluorophenyl)naphthalen-1-amine |
| SMILES | CN(c1c(F)cc(F)cc1F)c1cccc2ccccc12 |
| InChI | InChI=1S/C17H12F3N/c1-21(17-14(19)9-12(18)10-15(17)20)16-8-4-6-11-5-2-3-7-13(11)16/h2-10H,1H3 |
| InChIKey | QJCRWQLPKGIMME-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methyl-N-(2,4,6-trifluorophenyl)naphthalen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-(2,4,6-trifluorophenyl)naphthalen-1-amine?
The IUPAC name of N-methyl-N-(2,4,6-trifluorophenyl)naphthalen-1-amine (CID 59327767) is N-methyl-N-(2,4,6-trifluorophenyl)naphthalen-1-amine.
What is the SMILES notation for N-methyl-N-(2,4,6-trifluorophenyl)naphthalen-1-amine?
The canonical SMILES for N-methyl-N-(2,4,6-trifluorophenyl)naphthalen-1-amine is CN(c1c(F)cc(F)cc1F)c1cccc2ccccc12.
What is the InChIKey of N-methyl-N-(2,4,6-trifluorophenyl)naphthalen-1-amine?
The InChIKey is QJCRWQLPKGIMME-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12F3N/c1-21(17-14(19)9-12(18)10-15(17)20)16-8-4-6-11-5-2-3-7-13(11)16/h2-10H,1H3.
What are the key properties of N-methyl-N-(2,4,6-trifluorophenyl)naphthalen-1-amine?
N-methyl-N-(2,4,6-trifluorophenyl)naphthalen-1-amine has a molecular weight of 287.28 g/mol, XLogP of 5.03, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-(2,4,6-trifluorophenyl)naphthalen-1-amine is sourced from PubChem (CID 59327767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).