C20H13N3O5 — CID 59327840
13-(3-imidazol-1-ylpropyl)-6-oxa-13-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 59327840) has the molecular formula C20H13N3O5 and a molecular weight of 375.34 g/mol. Its IUPAC name is 13-(3-imidazol-1-ylpropyl)-6-oxa-13-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 13-(3-imidazol-1-ylpropyl)-6-oxa-13-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 59327840 |
| Molecular Formula | C20H13N3O5 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 13-(3-imidazol-1-ylpropyl)-6-oxa-13-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | O=C1OC(=O)c2ccc3c4c(ccc1c24)C(=O)N(CCCn1ccnc1)C3=O |
| InChI | InChI=1S/C20H13N3O5/c24-17-11-2-4-13-16-14(20(27)28-19(13)26)5-3-12(15(11)16)18(25)23(17)8-1-7-22-9-6-21-10-22/h2-6,9-10H,1,7-8H2 |
| InChIKey | OMKALVFLHINACQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 98.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|