C39H37F7O2 — CID 59328690
2-[[4-(4-but-3-enyl-3-fluorophenyl)-3-fluorophenoxy]-difluoromethyl]-5-[4-(4-butoxycyclohexyl)-2-fluorophenyl]-1,3-difluorobenzene (PubChem CID 59328690) has the molecular formula C39H37F7O2 and a molecular weight of 670.71 g/mol. Its IUPAC name is 2-[[4-(4-but-3-enyl-3-fluorophenyl)-3-fluorophenoxy]-difluoromethyl]-5-[4-(4-butoxycyclohexyl)-2-fluorophenyl]-1,3-difluorobenzene.
| Compound Name | 2-[[4-(4-but-3-enyl-3-fluorophenyl)-3-fluorophenoxy]-difluoromethyl]-5-[4-(4-butoxycyclohexyl)-2-fluorophenyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 59328690 |
| Molecular Formula | C39H37F7O2 |
| Molecular Weight | 670.71 g/mol |
| Exact Mass | 670.27 |
| IUPAC Name | 2-[[4-(4-but-3-enyl-3-fluorophenyl)-3-fluorophenoxy]-difluoromethyl]-5-[4-(4-butoxycyclohexyl)-2-fluorophenyl]-1,3-difluorobenzene |
| SMILES | C=CCCc1ccc(-c2ccc(OC(F)(F)c3c(F)cc(-c4ccc(C5CCC(OCCCC)CC5)cc4F)cc3F)cc2F)cc1F |
| InChI | InChI=1S/C39H37F7O2/c1-3-5-7-25-8-9-27(20-33(25)40)31-17-15-30(23-35(31)42)48-39(45,46)38-36(43)21-28(22-37(38)44)32-16-12-26(19-34(32)41)24-10-13-29(14-11-24)47-18-6-4-2/h3,8-9,12,15-17,19-24,29H,1,4-7,10-11,13-14,18H2,2H3 |
| InChIKey | OXLPXUAPCROJFX-UHFFFAOYSA-N |
| XLogP | 11.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.71 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|