C37H32F8O3 — CID 59329186
[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl] 2-fluoro-4-[4-(4-pentylcyclohexyl)phenyl]benzoate (PubChem CID 59329186) has the molecular formula C37H32F8O3 and a molecular weight of 676.64 g/mol. Its IUPAC name is [4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl] 2-fluoro-4-[4-(4-pentylcyclohexyl)phenyl]benzoate.
| Compound Name | [4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl] 2-fluoro-4-[4-(4-pentylcyclohexyl)phenyl]benzoate |
|---|---|
| PubChem CID | 59329186 |
| Molecular Formula | C37H32F8O3 |
| Molecular Weight | 676.64 g/mol |
| Exact Mass | 676.22 |
| IUPAC Name | [4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl] 2-fluoro-4-[4-(4-pentylcyclohexyl)phenyl]benzoate |
| SMILES | CCCCCC1CCC(c2ccc(-c3ccc(C(=O)Oc4cc(F)c(C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C37H32F8O3/c1-2-3-4-5-21-6-8-22(9-7-21)23-10-12-24(13-11-23)25-14-15-28(29(38)16-25)36(46)47-26-17-30(39)34(31(40)18-26)37(44,45)48-27-19-32(41)35(43)33(42)20-27/h10-22H,2-9H2,1H3 |
| InChIKey | DJWMOQJFCHBBBP-UHFFFAOYSA-N |
| XLogP | 11.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.64 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|