C36H39F7O — CID 59329296
5-[difluoro-[2-fluoro-4-[2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]methoxy]-1,2,3-trifluorobenzene (PubChem CID 59329296) has the molecular formula C36H39F7O and a molecular weight of 620.69 g/mol. Its IUPAC name is 5-[difluoro-[2-fluoro-4-[2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]methoxy]-1,2,3-trifluorobenzene.
| Compound Name | 5-[difluoro-[2-fluoro-4-[2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]methoxy]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 59329296 |
| Molecular Formula | C36H39F7O |
| Molecular Weight | 620.69 g/mol |
| Exact Mass | 620.29 |
| IUPAC Name | 5-[difluoro-[2-fluoro-4-[2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]methoxy]-1,2,3-trifluorobenzene |
| SMILES | CCCCCC1CCC(C2CCC(c3ccc(-c4ccc(C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C36H39F7O/c1-2-3-4-5-22-6-8-23(9-7-22)24-10-12-25(13-11-24)26-14-16-29(31(37)18-26)27-15-17-30(32(38)19-27)36(42,43)44-28-20-33(39)35(41)34(40)21-28/h14-25H,2-13H2,1H3 |
| InChIKey | PWDRVIPENQMTNV-UHFFFAOYSA-N |
| XLogP | 11.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.69 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|