C36H24F10O — CID 59329443
2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluorophenyl]-1,3-difluoro-5-[2-fluoro-4-(2-fluoro-4-pentylphenyl)phenyl]benzene (PubChem CID 59329443) has the molecular formula C36H24F10O and a molecular weight of 662.57 g/mol. Its IUPAC name is 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluorophenyl]-1,3-difluoro-5-[2-fluoro-4-(2-fluoro-4-pentylphenyl)phenyl]benzene.
| Compound Name | 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluorophenyl]-1,3-difluoro-5-[2-fluoro-4-(2-fluoro-4-pentylphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 59329443 |
| Molecular Formula | C36H24F10O |
| Molecular Weight | 662.57 g/mol |
| Exact Mass | 662.17 |
| IUPAC Name | 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluorophenyl]-1,3-difluoro-5-[2-fluoro-4-(2-fluoro-4-pentylphenyl)phenyl]benzene |
| SMILES | CCCCCc1ccc(-c2ccc(-c3cc(F)c(-c4ccc(C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C36H24F10O/c1-2-3-4-5-19-6-9-24(27(37)12-19)20-7-10-25(28(38)13-20)22-15-30(40)34(31(41)16-22)21-8-11-26(29(39)14-21)36(45,46)47-23-17-32(42)35(44)33(43)18-23/h6-18H,2-5H2,1H3 |
| InChIKey | GECGHPXIZFGOKW-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.57 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|