C38H41F7O3 — CID 59329641
2-[4-[4-[[4-(4-but-3-enyl-3,5-difluorophenyl)-3-fluorophenoxy]-difluoromethyl]-3,5-difluorophenyl]cyclohexyl]-5-pentyl-1,3-dioxane (PubChem CID 59329641) has the molecular formula C38H41F7O3 and a molecular weight of 678.73 g/mol. Its IUPAC name is 2-[4-[4-[[4-(4-but-3-enyl-3,5-difluorophenyl)-3-fluorophenoxy]-difluoromethyl]-3,5-difluorophenyl]cyclohexyl]-5-pentyl-1,3-dioxane.
| Compound Name | 2-[4-[4-[[4-(4-but-3-enyl-3,5-difluorophenyl)-3-fluorophenoxy]-difluoromethyl]-3,5-difluorophenyl]cyclohexyl]-5-pentyl-1,3-dioxane |
|---|---|
| PubChem CID | 59329641 |
| Molecular Formula | C38H41F7O3 |
| Molecular Weight | 678.73 g/mol |
| Exact Mass | 678.29 |
| IUPAC Name | 2-[4-[4-[[4-(4-but-3-enyl-3,5-difluorophenyl)-3-fluorophenoxy]-difluoromethyl]-3,5-difluorophenyl]cyclohexyl]-5-pentyl-1,3-dioxane |
| SMILES | C=CCCc1c(F)cc(-c2ccc(OC(F)(F)c3c(F)cc(C4CCC(C5OCC(CCCCC)CO5)CC4)cc3F)cc2F)cc1F |
| InChI | InChI=1S/C38H41F7O3/c1-3-5-7-8-23-21-46-37(47-22-23)25-12-10-24(11-13-25)26-16-34(42)36(35(43)17-26)38(44,45)48-28-14-15-29(33(41)20-28)27-18-31(39)30(9-6-4-2)32(40)19-27/h4,14-20,23-25,37H,2-3,5-13,21-22H2,1H3 |
| InChIKey | SDGVQSIACKJFME-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.73 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|