C25H22F5NO3 — CID 59330229
2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]phenyl]-5-(5-propyl-1,3-dioxan-2-yl)pyridine (PubChem CID 59330229) has the molecular formula C25H22F5NO3 and a molecular weight of 479.45 g/mol. Its IUPAC name is 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]phenyl]-5-(5-propyl-1,3-dioxan-2-yl)pyridine.
| Compound Name | 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]phenyl]-5-(5-propyl-1,3-dioxan-2-yl)pyridine |
|---|---|
| PubChem CID | 59330229 |
| Molecular Formula | C25H22F5NO3 |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]phenyl]-5-(5-propyl-1,3-dioxan-2-yl)pyridine |
| SMILES | CCCC1COC(c2ccc(-c3ccc(C(F)(F)Oc4cc(F)c(F)c(F)c4)cc3)nc2)OC1 |
| InChI | InChI=1S/C25H22F5NO3/c1-2-3-15-13-32-24(33-14-15)17-6-9-22(31-12-17)16-4-7-18(8-5-16)25(29,30)34-19-10-20(26)23(28)21(27)11-19/h4-12,15,24H,2-3,13-14H2,1H3 |
| InChIKey | XRQQYQYZHHYFOJ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|