C14H10F14 — CID 59330502
1,3-diethyl-2,2,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoroadamantane (PubChem CID 59330502) has the molecular formula C14H10F14 and a molecular weight of 444.21 g/mol. Its IUPAC name is 1,3-diethyl-2,2,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoroadamantane.
| Compound Name | 1,3-diethyl-2,2,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoroadamantane |
|---|---|
| PubChem CID | 59330502 |
| Molecular Formula | C14H10F14 |
| Molecular Weight | 444.21 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 1,3-diethyl-2,2,4,4,5,6,6,7,8,8,9,9,10,10-tetradecafluoroadamantane |
| SMILES | CCC12C(F)(F)C3(F)C(F)(F)C(F)(C1(F)F)C(F)(F)C(CC)(C3(F)F)C2(F)F |
| InChI | InChI=1S/C14H10F14/c1-3-5-9(17,18)6(4-2)12(23,24)7(15,10(5,19)20)14(27,28)8(16,11(5,21)22)13(6,25)26/h3-4H2,1-2H3 |
| InChIKey | NFGPFRFPSPDDPC-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.21 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |