C30H61N3O7Si3 — CID 59330596
ethyl 3-[1-[(2R,3S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1,2,4-triazol-3-yl]-3-hydroxypropanoate (PubChem CID 59330596) has the molecular formula C30H61N3O7Si3 and a molecular weight of 660.09 g/mol. Its IUPAC name is ethyl 3-[1-[(2R,3S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1,2,4-triazol-3-yl]-3-hydroxypropanoate.
| Compound Name | ethyl 3-[1-[(2R,3S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1,2,4-triazol-3-yl]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 59330596 |
| Molecular Formula | C30H61N3O7Si3 |
| Molecular Weight | 660.09 g/mol |
| Exact Mass | 659.38 |
| IUPAC Name | ethyl 3-[1-[(2R,3S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1,2,4-triazol-3-yl]-3-hydroxypropanoate |
| SMILES | CCOC(=O)CC(O)c1ncn([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)n1 |
| InChI | InChI=1S/C30H61N3O7Si3/c1-17-36-23(35)18-21(34)26-31-20-33(32-26)27-25(40-43(15,16)30(8,9)10)24(39-42(13,14)29(5,6)7)22(38-27)19-37-41(11,12)28(2,3)4/h20-22,24-25,27,34H,17-19H2,1-16H3/t21?,22-,24?,25+,27-/m1/s1 |
| InChIKey | OGPPFWMXJUOPTR-RTJJEUGTSA-N |
| XLogP | 6.96 |
| TPSA | 114.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.09 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|