C10H11N3O — CID 59330649
(1-methyl-1,2,4-triazol-3-yl)-phenylmethanol (PubChem CID 59330649) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is (1-methyl-1,2,4-triazol-3-yl)-phenylmethanol.
| Compound Name | (1-methyl-1,2,4-triazol-3-yl)-phenylmethanol |
|---|---|
| PubChem CID | 59330649 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | (1-methyl-1,2,4-triazol-3-yl)-phenylmethanol |
| SMILES | Cn1cnc(C(O)c2ccccc2)n1 |
| InChI | InChI=1S/C10H11N3O/c1-13-7-11-10(12-13)9(14)8-5-3-2-4-6-8/h2-7,9,14H,1H3 |
| InChIKey | DHVIOJSTMQKEMQ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |