About 1,3-dibromo-5-[2-(2,4-dichlorophenyl)ethoxy]benzene
1,3-dibromo-5-[2-(2,4-dichlorophenyl)ethoxy]benzene (PubChem CID 59330945) has the molecular formula C14H10Br2Cl2O
and a molecular weight of 424.95 g/mol. Its IUPAC name is 1,3-dibromo-5-[2-(2,4-dichlorophenyl)ethoxy]benzene.
Molecular Properties
| Compound Name | 1,3-dibromo-5-[2-(2,4-dichlorophenyl)ethoxy]benzene |
| PubChem CID | 59330945 |
| Molecular Formula | C14H10Br2Cl2O |
| Molecular Weight | 424.95 g/mol |
| Exact Mass | 421.85 |
| IUPAC Name | 1,3-dibromo-5-[2-(2,4-dichlorophenyl)ethoxy]benzene |
| SMILES | Clc1ccc(CCOc2cc(Br)cc(Br)c2)c(Cl)c1 |
| InChI | InChI=1S/C14H10Br2Cl2O/c15-10-5-11(16)7-13(6-10)19-4-3-9-1-2-12(17)8-14(9)18/h1-2,5-8H,3-4H2 |
| InChIKey | OHPXCYCTCVVMDU-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.95 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-dibromo-5-[2-(2,4-dichlorophenyl)ethoxy]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibromo-5-[2-(2,4-dichlorophenyl)ethoxy]benzene?
The IUPAC name of 1,3-dibromo-5-[2-(2,4-dichlorophenyl)ethoxy]benzene (CID 59330945) is 1,3-dibromo-5-[2-(2,4-dichlorophenyl)ethoxy]benzene.
What is the SMILES notation for 1,3-dibromo-5-[2-(2,4-dichlorophenyl)ethoxy]benzene?
The canonical SMILES for 1,3-dibromo-5-[2-(2,4-dichlorophenyl)ethoxy]benzene is Clc1ccc(CCOc2cc(Br)cc(Br)c2)c(Cl)c1.
What is the InChIKey of 1,3-dibromo-5-[2-(2,4-dichlorophenyl)ethoxy]benzene?
The InChIKey is OHPXCYCTCVVMDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Br2Cl2O/c15-10-5-11(16)7-13(6-10)19-4-3-9-1-2-12(17)8-14(9)18/h1-2,5-8H,3-4H2.
What are the key properties of 1,3-dibromo-5-[2-(2,4-dichlorophenyl)ethoxy]benzene?
1,3-dibromo-5-[2-(2,4-dichlorophenyl)ethoxy]benzene has a molecular weight of 424.95 g/mol, XLogP of 6.14, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibromo-5-[2-(2,4-dichlorophenyl)ethoxy]benzene is sourced from PubChem (CID 59330945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).